C29H46O3 — CID 11690794
cis-(1S,3R)-5-[(2E)-2-[(3R,5S)-3-[(3Z,5E)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]spiro[4.5]decan-9-ylidene]ethylidene]cyclohexane-1,3-diol (PubChem CID 11690794) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is cis-(1S,3R)-5-[(2E)-2-[(3R,5S)-3-[(3Z,5E)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]spiro[4.5]decan-9-ylidene]ethylidene]cyclohexane-1,3-diol.
| Compound Name | cis-(1S,3R)-5-[(2E)-2-[(3R,5S)-3-[(3Z,5E)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]spiro[4.5]decan-9-ylidene]ethylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11690794 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | cis-(1S,3R)-5-[(2E)-2-[(3R,5S)-3-[(3Z,5E)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]spiro[4.5]decan-9-ylidene]ethylidene]cyclohexane-1,3-diol |
| SMILES | CCC(O)(/C=C/C=C\C(C)[C@@H]1CC[C@@]2(CCC/C(=C\C=C3\C[C@@H](O)C[C@@H](O)C3)C2)C1)CC |
| InChI | InChI=1S/C29H46O3/c1-4-29(32,5-2)15-7-6-9-22(3)25-13-16-28(21-25)14-8-10-23(20-28)11-12-24-17-26(30)19-27(31)18-24/h6-7,9,11-12,15,22,25-27,30-32H,4-5,8,10,13-14,16-21H2,1-3H3/b9-6-,15-7+,23-11+,24-12-/t22?,25-,26-,27+,28-/m1/s1 |
| InChIKey | SYRJCLFPTSGNOD-DAQLCQEKSA-N |
| XLogP | 6.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|