C28H41NO8 — CID 11519223
(4E,8S,9S,10E,12R,13S,14S,16S)-9,13-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione (PubChem CID 11519223) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is (4E,8S,9S,10E,12R,13S,14S,16S)-9,13-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione.
| Compound Name | (4E,8S,9S,10E,12R,13S,14S,16S)-9,13-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione |
|---|---|
| PubChem CID | 11519223 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (4E,8S,9S,10E,12R,13S,14S,16S)-9,13-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione |
| SMILES | COC1=C2C[C@H](C)C[C@H](OC)[C@@H](O)[C@H](C)/C=C(\C)[C@H](O)[C@@H](OC)CC/C=C(\C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C28H41NO8/c1-15-11-19-26(33)20(14-21(30)27(19)37-7)29-28(34)16(2)9-8-10-22(35-5)24(31)17(3)13-18(4)25(32)23(12-15)36-6/h9,13-15,18,22-25,31-32H,8,10-12H2,1-7H3,(H,29,34)/b16-9+,17-13+/t15-,18+,22-,23-,24-,25-/m0/s1 |
| InChIKey | STJZXLRSQNVEGC-SHOSWUJHSA-N |
| XLogP | 2.53 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|