C27H41NO6 — CID 91580268
(8S,9S,12S,13R,14S,16R)-9,13,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one (PubChem CID 91580268) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is (8S,9S,12S,13R,14S,16R)-9,13,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one.
| Compound Name | (8S,9S,12S,13R,14S,16R)-9,13,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one |
|---|---|
| PubChem CID | 91580268 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | (8S,9S,12S,13R,14S,16R)-9,13,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one |
| SMILES | CO[C@H]1C[C@H](C)Cc2cc(O)cc(c2)NC(=O)C(C)=CCC[C@H](OC)[C@@H](O)C(C)=C[C@H](C)[C@H]1O |
| InChI | InChI=1S/C27H41NO6/c1-16-10-20-13-21(15-22(29)14-20)28-27(32)17(2)8-7-9-23(33-5)25(30)18(3)12-19(4)26(31)24(11-16)34-6/h8,12-16,19,23-26,29-31H,7,9-11H2,1-6H3,(H,28,32)/t16-,19+,23+,24+,25+,26-/m1/s1 |
| InChIKey | JUHXUUXMSBXUJZ-LIADPBFPSA-N |
| XLogP | 3.97 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|