C26H39NO5 — CID 162821032
(4Z,8S,9R,10Z,12S,13R,14S,16R)-9,13,14,20-tetrahydroxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one (PubChem CID 162821032) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is (4Z,8S,9R,10Z,12S,13R,14S,16R)-9,13,14,20-tetrahydroxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one.
| Compound Name | (4Z,8S,9R,10Z,12S,13R,14S,16R)-9,13,14,20-tetrahydroxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one |
|---|---|
| PubChem CID | 162821032 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (4Z,8S,9R,10Z,12S,13R,14S,16R)-9,13,14,20-tetrahydroxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-3-one |
| SMILES | C/C1=C/CC[C@H](C)[C@@H](O)/C(C)=C\[C@H](C)[C@@H](O)[C@@H](O)C[C@H](C)Cc2cc(O)cc(c2)NC1=O |
| InChI | InChI=1S/C26H39NO5/c1-15-9-20-12-21(14-22(28)13-20)27-26(32)17(3)8-6-7-16(2)24(30)18(4)11-19(5)25(31)23(29)10-15/h8,11-16,19,23-25,28-31H,6-7,9-10H2,1-5H3,(H,27,32)/b17-8-,18-11-/t15-,16+,19+,23+,24-,25-/m1/s1 |
| InChIKey | HPTSDSLSOBEPPP-DEFRPFTDSA-N |
| XLogP | 3.94 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|