C28H42N2O7 — CID 24861386
[(4E,8S,9R,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-9-yl] carbamate (PubChem CID 24861386) has the molecular formula C28H42N2O7 and a molecular weight of 518.65 g/mol. Its IUPAC name is [(4E,8S,9R,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-9-yl] carbamate.
| Compound Name | [(4E,8S,9R,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 24861386 |
| Molecular Formula | C28H42N2O7 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [(4E,8S,9R,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18(22),19-pentaen-9-yl] carbamate |
| SMILES | CO[C@H]1C[C@H](C)[C@@H](O)c2cc(O)cc(c2)NC(=O)/C(C)=C/CC[C@H](C)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@H]1O |
| InChI | InChI=1S/C28H42N2O7/c1-15-8-7-9-16(2)27(34)30-21-12-20(13-22(31)14-21)24(32)18(4)11-23(36-6)25(33)17(3)10-19(5)26(15)37-28(29)35/h9-10,12-15,17-18,23-26,31-33H,7-8,11H2,1-6H3,(H2,29,35)(H,30,34)/b16-9+,19-10+/t15-,17-,18-,23-,24+,25+,26+/m0/s1 |
| InChIKey | LBNWXNLPJPGKSU-FHCPNLCOSA-N |
| XLogP | 4.19 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|