C28H40N2O8 — CID 53327756
[(4E,8S,9S,10E,12S,13R,14Z,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,14,18(22),19-hexaen-9-yl] carbamate (PubChem CID 53327756) has the molecular formula C28H40N2O8 and a molecular weight of 532.63 g/mol. Its IUPAC name is [(4E,8S,9S,10E,12S,13R,14Z,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,14,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,8S,9S,10E,12S,13R,14Z,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,14,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 53327756 |
| Molecular Formula | C28H40N2O8 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | [(4E,8S,9S,10E,12S,13R,14Z,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,14,18(22),19-hexaen-9-yl] carbamate |
| SMILES | CO/C1=C\[C@H](C)[C@@H](O)c2cc(O)cc(c2)NC(=O)/C(C)=C/CC[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@H]1O |
| InChI | InChI=1S/C28H40N2O8/c1-15-8-7-9-22(36-5)26(38-28(29)35)18(4)10-16(2)25(33)23(37-6)11-17(3)24(32)19-12-20(30-27(15)34)14-21(31)13-19/h8,10-14,16-17,22,24-26,31-33H,7,9H2,1-6H3,(H2,29,35)(H,30,34)/b15-8+,18-10+,23-11-/t16-,17-,22-,24+,25+,26-/m0/s1 |
| InChIKey | VOPKEVWEROGIJO-VDJBKCIYSA-N |
| XLogP | 3.69 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|