About N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide (PubChem CID 11521398) has the molecular formula C10H9N3O3
and a molecular weight of 219.20 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide |
| PubChem CID | 11521398 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C10H9N3O3/c1-5(14)11-7-4-2-3-6-8(7)10(16)13-12-9(6)15/h2-4H,1H3,(H,11,14)(H,12,15)(H,13,16) |
| InChIKey | QWAGPPBLDNLTBB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide?
The IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide (CID 11521398) is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide.
What is the SMILES notation for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide?
The canonical SMILES for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide is CC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12.
What is the InChIKey of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide?
The InChIKey is QWAGPPBLDNLTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c1-5(14)11-7-4-2-3-6-8(7)10(16)13-12-9(6)15/h2-4H,1H3,(H,11,14)(H,12,15)(H,13,16).
What are the key properties of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide?
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide has a molecular weight of 219.20 g/mol, XLogP of 0.17, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide is sourced from PubChem (CID 11521398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).