C10H9N3O3 — CID 11521398
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide (PubChem CID 11521398) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide |
|---|---|
| PubChem CID | 11521398 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C10H9N3O3/c1-5(14)11-7-4-2-3-6-8(7)10(16)13-12-9(6)15/h2-4H,1H3,(H,11,14)(H,12,15)(H,13,16) |
| InChIKey | QWAGPPBLDNLTBB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |