C15H24O — CID 11521404
6,6,10,10-tetramethyltricyclo[6.2.1.02,7]undecan-3-one (PubChem CID 11521404) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 6,6,10,10-tetramethyltricyclo[6.2.1.02,7]undecan-3-one.
| Compound Name | 6,6,10,10-tetramethyltricyclo[6.2.1.02,7]undecan-3-one |
|---|---|
| PubChem CID | 11521404 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 6,6,10,10-tetramethyltricyclo[6.2.1.02,7]undecan-3-one |
| SMILES | CC1(C)CC2CC1C1C(=O)CCC(C)(C)C21 |
| InChI | InChI=1S/C15H24O/c1-14(2)6-5-11(16)12-10-7-9(13(12)14)8-15(10,3)4/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | KWFSRLYDIXIWEF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |