C13H18N2OS — CID 115224728
6-(methylamino)-1-(3-sulfanylpropyl)-3,4-dihydroquinolin-2-one (PubChem CID 115224728) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 6-(methylamino)-1-(3-sulfanylpropyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(methylamino)-1-(3-sulfanylpropyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 115224728 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-(methylamino)-1-(3-sulfanylpropyl)-3,4-dihydroquinolin-2-one |
| SMILES | CNc1ccc2c(c1)CCC(=O)N2CCCS |
| InChI | InChI=1S/C13H18N2OS/c1-14-11-4-5-12-10(9-11)3-6-13(16)15(12)7-2-8-17/h4-5,9,14,17H,2-3,6-8H2,1H3 |
| InChIKey | JOIKZCRXRDKVDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|