C13H10ClN3OS2 — CID 11522675
1-(4-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 11522675) has the molecular formula C13H10ClN3OS2 and a molecular weight of 323.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 11522675 |
| Molecular Formula | C13H10ClN3OS2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(C(=C1SCCS1)n1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClN3OS2/c14-10-3-1-9(2-4-10)12(18)11(13-19-5-6-20-13)17-8-15-7-16-17/h1-4,7-8H,5-6H2 |
| InChIKey | XWHWUPMONZJWAJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|