C22H33N3O2 — CID 11523596
5-[[(3S)-3-(3-methoxypropoxy)pyrrolidin-1-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-1H-indole (PubChem CID 11523596) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 5-[[(3S)-3-(3-methoxypropoxy)pyrrolidin-1-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-1H-indole.
| Compound Name | 5-[[(3S)-3-(3-methoxypropoxy)pyrrolidin-1-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 11523596 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 5-[[(3S)-3-(3-methoxypropoxy)pyrrolidin-1-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-1H-indole |
| SMILES | COCCCO[C@H]1CCN(Cc2ccc3[nH]c(CN4CCCC4)cc3c2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-26-11-4-12-27-21-7-10-25(17-21)15-18-5-6-22-19(13-18)14-20(23-22)16-24-8-2-3-9-24/h5-6,13-14,21,23H,2-4,7-12,15-17H2,1H3/t21-/m0/s1 |
| InChIKey | XZGGVFMFIUZCGC-NRFANRHFSA-N |
| XLogP | 3.39 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|