C13H18N2O3 — CID 115241034
2-amino-4-(3,4-dihydro-2H-chromen-6-ylamino)butanoic acid (PubChem CID 115241034) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-amino-4-(3,4-dihydro-2H-chromen-6-ylamino)butanoic acid.
| Compound Name | 2-amino-4-(3,4-dihydro-2H-chromen-6-ylamino)butanoic acid |
|---|---|
| PubChem CID | 115241034 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-amino-4-(3,4-dihydro-2H-chromen-6-ylamino)butanoic acid |
| SMILES | NC(CCNc1ccc2c(c1)CCCO2)C(=O)O |
| InChI | InChI=1S/C13H18N2O3/c14-11(13(16)17)5-6-15-10-3-4-12-9(8-10)2-1-7-18-12/h3-4,8,11,15H,1-2,5-7,14H2,(H,16,17) |
| InChIKey | UZPYPAYVEXAGOZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|