C14H17NO4 — CID 115243068
1-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 115243068) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115243068 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNCCc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C14H17NO4/c16-13(17)14(4-5-14)8-15-6-3-10-1-2-11-12(7-10)19-9-18-11/h1-2,7,15H,3-6,8-9H2,(H,16,17) |
| InChIKey | LTNFRCGISNOMQV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|