C21H22ClF3N2O6 — CID 11526047
[1-(4-chlorophenyl)-3-(dimethylamino)propyl] N-[4-(trifluoromethyl)phenyl]carbamate;oxalic acid (PubChem CID 11526047) has the molecular formula C21H22ClF3N2O6 and a molecular weight of 490.86 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-(dimethylamino)propyl] N-[4-(trifluoromethyl)phenyl]carbamate;oxalic acid.
| Compound Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] N-[4-(trifluoromethyl)phenyl]carbamate;oxalic acid |
|---|---|
| PubChem CID | 11526047 |
| Molecular Formula | C21H22ClF3N2O6 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] N-[4-(trifluoromethyl)phenyl]carbamate;oxalic acid |
| SMILES | CN(C)CCC(OC(=O)Nc1ccc(C(F)(F)F)cc1)c1ccc(Cl)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20ClF3N2O2.C2H2O4/c1-25(2)12-11-17(13-3-7-15(20)8-4-13)27-18(26)24-16-9-5-14(6-10-16)19(21,22)23;3-1(4)2(5)6/h3-10,17H,11-12H2,1-2H3,(H,24,26);(H,3,4)(H,5,6) |
| InChIKey | XHJINMKEMQCRCV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|