C21H22ClF3N2O — CID 11983241
(E)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 11983241) has the molecular formula C21H22ClF3N2O and a molecular weight of 410.87 g/mol. Its IUPAC name is (E)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11983241 |
| Molecular Formula | C21H22ClF3N2O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (E)-N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN(C)CCC(NC(=O)/C=C/c1ccc(C(F)(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClF3N2O/c1-27(2)14-13-19(16-6-10-18(22)11-7-16)26-20(28)12-5-15-3-8-17(9-4-15)21(23,24)25/h3-12,19H,13-14H2,1-2H3,(H,26,28)/b12-5+ |
| InChIKey | OACORGJUEPUCKC-LFYBBSHMSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|