C11H11BrN4OS — CID 115265023
1-[[6-[(5-bromothiophen-2-yl)amino]pyrimidin-4-yl]amino]propan-2-one (PubChem CID 115265023) has the molecular formula C11H11BrN4OS and a molecular weight of 327.21 g/mol. Its IUPAC name is 1-[[6-[(5-bromothiophen-2-yl)amino]pyrimidin-4-yl]amino]propan-2-one.
| Compound Name | 1-[[6-[(5-bromothiophen-2-yl)amino]pyrimidin-4-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 115265023 |
| Molecular Formula | C11H11BrN4OS |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1-[[6-[(5-bromothiophen-2-yl)amino]pyrimidin-4-yl]amino]propan-2-one |
| SMILES | CC(=O)CNc1cc(Nc2ccc(Br)s2)ncn1 |
| InChI | InChI=1S/C11H11BrN4OS/c1-7(17)5-13-9-4-10(15-6-14-9)16-11-3-2-8(12)18-11/h2-4,6H,5H2,1H3,(H2,13,14,15,16) |
| InChIKey | SYYBWARQHFPDLF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |