C13H20N6 — CID 115266404
2-methyl-6-N-[3-(methylamino)propyl]-4-N-(1H-pyrrol-2-yl)pyrimidine-4,6-diamine (PubChem CID 115266404) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methyl-6-N-[3-(methylamino)propyl]-4-N-(1H-pyrrol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-6-N-[3-(methylamino)propyl]-4-N-(1H-pyrrol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115266404 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-methyl-6-N-[3-(methylamino)propyl]-4-N-(1H-pyrrol-2-yl)pyrimidine-4,6-diamine |
| SMILES | CNCCCNc1cc(Nc2ccc[nH]2)nc(C)n1 |
| InChI | InChI=1S/C13H20N6/c1-10-17-12(16-8-4-6-14-2)9-13(18-10)19-11-5-3-7-15-11/h3,5,7,9,14-15H,4,6,8H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | OIIUWLAJTILWJG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|