C10H12BrNO3S2 — CID 115275099
1-(4-bromothiophen-2-yl)sulfonyl-2,2-dimethylpyrrolidin-3-one (PubChem CID 115275099) has the molecular formula C10H12BrNO3S2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)sulfonyl-2,2-dimethylpyrrolidin-3-one.
| Compound Name | 1-(4-bromothiophen-2-yl)sulfonyl-2,2-dimethylpyrrolidin-3-one |
|---|---|
| PubChem CID | 115275099 |
| Molecular Formula | C10H12BrNO3S2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)sulfonyl-2,2-dimethylpyrrolidin-3-one |
| SMILES | CC1(C)C(=O)CCN1S(=O)(=O)c1cc(Br)cs1 |
| InChI | InChI=1S/C10H12BrNO3S2/c1-10(2)8(13)3-4-12(10)17(14,15)9-5-7(11)6-16-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | LGUGCJJDTAQCTP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |