C15H18N4OS — CID 115281590
N-[4-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 115281590) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[4-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 115281590 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[4-[(5-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CN2CCCc3c(N)cccc32)cs1 |
| InChI | InChI=1S/C15H18N4OS/c1-10(20)17-15-18-11(9-21-15)8-19-7-3-4-12-13(16)5-2-6-14(12)19/h2,5-6,9H,3-4,7-8,16H2,1H3,(H,17,18,20) |
| InChIKey | UTGJXFUSJBMVNE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|