C15H16BrN3 — CID 115777489
1-[(5-bromo-2-pyridinyl)methyl]-3,4-dihydro-2H-quinolin-5-amine (PubChem CID 115777489) has the molecular formula C15H16BrN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is 1-[(5-bromo-2-pyridinyl)methyl]-3,4-dihydro-2H-quinolin-5-amine.
| Compound Name | 1-[(5-bromo-2-pyridinyl)methyl]-3,4-dihydro-2H-quinolin-5-amine |
|---|---|
| PubChem CID | 115777489 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[(5-bromo-2-pyridinyl)methyl]-3,4-dihydro-2H-quinolin-5-amine |
| SMILES | Nc1cccc2c1CCCN2Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C15H16BrN3/c16-11-6-7-12(18-9-11)10-19-8-2-3-13-14(17)4-1-5-15(13)19/h1,4-7,9H,2-3,8,10,17H2 |
| InChIKey | BTLVGWSBKOHBTG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|