About 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile
4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile (PubChem CID 115310173) has the molecular formula C14H19F2N3
and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile |
| PubChem CID | 115310173 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile |
| SMILES | CC(C)CC(C)(CN)Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C14H19F2N3/c1-9(2)6-14(3,8-18)19-13-11(15)4-10(7-17)5-12(13)16/h4-5,9,19H,6,8,18H2,1-3H3 |
| InChIKey | PGBCUMDPBBFPNI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile?
The IUPAC name of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile (CID 115310173) is 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile is CC(C)CC(C)(CN)Nc1c(F)cc(C#N)cc1F.
What is the InChIKey of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile?
The InChIKey is PGBCUMDPBBFPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2N3/c1-9(2)6-14(3,8-18)19-13-11(15)4-10(7-17)5-12(13)16/h4-5,9,19H,6,8,18H2,1-3H3.
What are the key properties of 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile?
4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile has a molecular weight of 267.32 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-amino-2,4-dimethylpentan-2-yl)amino]-3,5-difluorobenzonitrile is sourced from PubChem (CID 115310173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).