About methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate
methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate (PubChem CID 115310836) has the molecular formula C14H20F2N2O2
and a molecular weight of 286.32 g/mol. Its IUPAC name is methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate |
| PubChem CID | 115310836 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate |
| SMILES | COC(=O)c1ccc(NC(C)(CN)C(C)C)c(F)c1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-8(2)14(3,7-17)18-10-6-5-9(13(19)20-4)11(15)12(10)16/h5-6,8,18H,7,17H2,1-4H3 |
| InChIKey | YKAHNDRNGUFEGK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate?
The IUPAC name of methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate (CID 115310836) is methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate.
What is the SMILES notation for methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate?
The canonical SMILES for methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate is COC(=O)c1ccc(NC(C)(CN)C(C)C)c(F)c1F.
What is the InChIKey of methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate?
The InChIKey is YKAHNDRNGUFEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O2/c1-8(2)14(3,7-17)18-10-6-5-9(13(19)20-4)11(15)12(10)16/h5-6,8,18H,7,17H2,1-4H3.
What are the key properties of methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate?
methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate has a molecular weight of 286.32 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2,3-difluorobenzoate is sourced from PubChem (CID 115310836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).