C11H15N5O2S — CID 115320081
2-[2-(4-aminopyrazol-1-yl)ethylamino]benzenesulfonamide (PubChem CID 115320081) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[2-(4-aminopyrazol-1-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-[2-(4-aminopyrazol-1-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 115320081 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[2-(4-aminopyrazol-1-yl)ethylamino]benzenesulfonamide |
| SMILES | Nc1cnn(CCNc2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15N5O2S/c12-9-7-15-16(8-9)6-5-14-10-3-1-2-4-11(10)19(13,17)18/h1-4,7-8,14H,5-6,12H2,(H2,13,17,18) |
| InChIKey | BPOFVUCDJKPYTH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |