C15H19FN4O2S — CID 6465735
1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-(2-fluorophenyl)piperazine (PubChem CID 6465735) has the molecular formula C15H19FN4O2S and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 6465735 |
| Molecular Formula | C15H19FN4O2S |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-(2-fluorophenyl)piperazine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H19FN4O2S/c1-12-15(11-18(2)17-12)23(21,22)20-9-7-19(8-10-20)14-6-4-3-5-13(14)16/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | FFYJQJBSWCZUIU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |