About (8-aminoquinolin-5-yl) thiocyanate
(8-aminoquinolin-5-yl) thiocyanate (PubChem CID 115327856) has the molecular formula C10H7N3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is (8-aminoquinolin-5-yl) thiocyanate.
Molecular Properties
| Compound Name | (8-aminoquinolin-5-yl) thiocyanate |
| PubChem CID | 115327856 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (8-aminoquinolin-5-yl) thiocyanate |
| SMILES | N#CSc1ccc(N)c2ncccc12 |
| InChI | InChI=1S/C10H7N3S/c11-6-14-9-4-3-8(12)10-7(9)2-1-5-13-10/h1-5H,12H2 |
| InChIKey | ASRXJBUNOZZBOV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (8-aminoquinolin-5-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-aminoquinolin-5-yl) thiocyanate?
The IUPAC name of (8-aminoquinolin-5-yl) thiocyanate (CID 115327856) is (8-aminoquinolin-5-yl) thiocyanate.
What is the SMILES notation for (8-aminoquinolin-5-yl) thiocyanate?
The canonical SMILES for (8-aminoquinolin-5-yl) thiocyanate is N#CSc1ccc(N)c2ncccc12.
What is the InChIKey of (8-aminoquinolin-5-yl) thiocyanate?
The InChIKey is ASRXJBUNOZZBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S/c11-6-14-9-4-3-8(12)10-7(9)2-1-5-13-10/h1-5H,12H2.
What are the key properties of (8-aminoquinolin-5-yl) thiocyanate?
(8-aminoquinolin-5-yl) thiocyanate has a molecular weight of 201.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-aminoquinolin-5-yl) thiocyanate is sourced from PubChem (CID 115327856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).