About 6-fluoroquinolin-8-amine
6-fluoroquinolin-8-amine (PubChem CID 13227992) has the molecular formula C9H7FN2
and a molecular weight of 162.17 g/mol. Its IUPAC name is 6-fluoroquinolin-8-amine.
Molecular Properties
| Compound Name | 6-fluoroquinolin-8-amine |
| PubChem CID | 13227992 |
| Molecular Formula | C9H7FN2 |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 6-fluoroquinolin-8-amine |
| SMILES | Nc1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C9H7FN2/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h1-5H,11H2 |
| InChIKey | IKGWILBMHTUNJB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoroquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoroquinolin-8-amine?
The IUPAC name of 6-fluoroquinolin-8-amine (CID 13227992) is 6-fluoroquinolin-8-amine.
What is the SMILES notation for 6-fluoroquinolin-8-amine?
The canonical SMILES for 6-fluoroquinolin-8-amine is Nc1cc(F)cc2cccnc12.
What is the InChIKey of 6-fluoroquinolin-8-amine?
The InChIKey is IKGWILBMHTUNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h1-5H,11H2.
What are the key properties of 6-fluoroquinolin-8-amine?
6-fluoroquinolin-8-amine has a molecular weight of 162.17 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoroquinolin-8-amine is sourced from PubChem (CID 13227992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).