C14H13N3O2 — CID 115340258
4-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline (PubChem CID 115340258) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline.
| Compound Name | 4-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
|---|---|
| PubChem CID | 115340258 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
| SMILES | Nc1ccc(CCc2nc(-c3ccco3)no2)cc1 |
| InChI | InChI=1S/C14H13N3O2/c15-11-6-3-10(4-7-11)5-8-13-16-14(17-19-13)12-2-1-9-18-12/h1-4,6-7,9H,5,8,15H2 |
| InChIKey | WPHMUIWJBHDICU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|