C24H32ClFN6O2S2 — CID 11534128
N-[(1R,2S,5S)-5-(dimethylamino)-2-[[2-(4-fluoroanilino)-2-oxoethanethioyl]amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride (PubChem CID 11534128) has the molecular formula C24H32ClFN6O2S2 and a molecular weight of 555.15 g/mol. Its IUPAC name is N-[(1R,2S,5S)-5-(dimethylamino)-2-[[2-(4-fluoroanilino)-2-oxoethanethioyl]amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[(1R,2S,5S)-5-(dimethylamino)-2-[[2-(4-fluoroanilino)-2-oxoethanethioyl]amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11534128 |
| Molecular Formula | C24H32ClFN6O2S2 |
| Molecular Weight | 555.15 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | N-[(1R,2S,5S)-5-(dimethylamino)-2-[[2-(4-fluoroanilino)-2-oxoethanethioyl]amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](N(C)C)CC[C@@H]3NC(=S)C(=O)Nc3ccc(F)cc3)sc2C1.Cl |
| InChI | InChI=1S/C24H31FN6O2S2.ClH/c1-30(2)16-8-9-17(28-23(34)21(32)26-15-6-4-14(25)5-7-15)19(12-16)27-22(33)24-29-18-10-11-31(3)13-20(18)35-24;/h4-7,16-17,19H,8-13H2,1-3H3,(H,26,32)(H,27,33)(H,28,34);1H/t16-,17-,19+;/m0./s1 |
| InChIKey | PVMBAEGYMOENKK-ITJMAPPJSA-N |
| XLogP | 2.83 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|