C8H15NO2 — CID 115347716
(Z)-2,5-dimethyl-3-nitrohex-3-ene (PubChem CID 115347716) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-3-nitrohex-3-ene.
| Compound Name | (Z)-2,5-dimethyl-3-nitrohex-3-ene |
|---|---|
| PubChem CID | 115347716 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (Z)-2,5-dimethyl-3-nitrohex-3-ene |
| SMILES | CC(C)/C=C(/C(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO2/c1-6(2)5-8(7(3)4)9(10)11/h5-7H,1-4H3/b8-5- |
| InChIKey | FWVOWFKGBMHZFS-YVMONPNESA-N |
| XLogP | 2.46 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|