C6H11NO3 — CID 10558746
(E,2R,5R)-5-nitrohex-3-en-2-ol (PubChem CID 10558746) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (E,2R,5R)-5-nitrohex-3-en-2-ol.
| Compound Name | (E,2R,5R)-5-nitrohex-3-en-2-ol |
|---|---|
| PubChem CID | 10558746 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (E,2R,5R)-5-nitrohex-3-en-2-ol |
| SMILES | C[C@H](/C=C/[C@@H](C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C6H11NO3/c1-5(7(9)10)3-4-6(2)8/h3-6,8H,1-2H3/b4-3+/t5-,6-/m1/s1 |
| InChIKey | YIXUIRRDAPDFAL-BYVKAKODSA-N |
| XLogP | 0.59 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|