C15H18F4N2 — CID 115350848
2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine (PubChem CID 115350848) has the molecular formula C15H18F4N2 and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 115350848 |
| Molecular Formula | C15H18F4N2 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NCC(c1cc(F)cc(C(F)(F)F)c1)N1CC2CCC1C2 |
| InChI | InChI=1S/C15H18F4N2/c16-12-5-10(4-11(6-12)15(17,18)19)14(7-20)21-8-9-1-2-13(21)3-9/h4-6,9,13-14H,1-3,7-8,20H2 |
| InChIKey | PZZKZIKCDDMYGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |