C13H20ClN5O — CID 115357093
N-tert-butyl-2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide (PubChem CID 115357093) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide.
| Compound Name | N-tert-butyl-2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide |
|---|---|
| PubChem CID | 115357093 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-tert-butyl-2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H20ClN5O/c1-8-11-12(18(5)17-8)19(9(6-14)15-11)7-10(20)16-13(2,3)4/h6-7H2,1-5H3,(H,16,20) |
| InChIKey | HLENHSZZRWQJNW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|