C10H11ClF4N4 — CID 106294984
5-(chloromethyl)-1,3-dimethyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazole (PubChem CID 106294984) has the molecular formula C10H11ClF4N4 and a molecular weight of 298.67 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 106294984 |
| Molecular Formula | C10H11ClF4N4 |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H11ClF4N4/c1-5-7-8(18(2)17-5)19(6(3-11)16-7)4-10(14,15)9(12)13/h9H,3-4H2,1-2H3 |
| InChIKey | MBHSQKBOTBZSFD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|