C16H24BrNO3 — CID 115359523
1-(3-bromophenoxy)-3-[[1-(hydroxymethyl)cyclopentyl]methylamino]propan-2-ol (PubChem CID 115359523) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-[[1-(hydroxymethyl)cyclopentyl]methylamino]propan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-[[1-(hydroxymethyl)cyclopentyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 115359523 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(3-bromophenoxy)-3-[[1-(hydroxymethyl)cyclopentyl]methylamino]propan-2-ol |
| SMILES | OCC1(CNCC(O)COc2cccc(Br)c2)CCCC1 |
| InChI | InChI=1S/C16H24BrNO3/c17-13-4-3-5-15(8-13)21-10-14(20)9-18-11-16(12-19)6-1-2-7-16/h3-5,8,14,18-20H,1-2,6-7,9-12H2 |
| InChIKey | DZLMRCKKRXQYNB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |