C17H30O5Si — CID 11537459
tert-butyl [(2S,3S)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate (PubChem CID 11537459) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2S,3S)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 11537459 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl [(2S,3S)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@@H]1O[C@H]1CCCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-17(2,3)22-16(19)20-12-15-14(21-15)9-7-8-13(18)10-11-23(4,5)6/h13-15,18H,7-9,12H2,1-6H3/t13?,14-,15-/m0/s1 |
| InChIKey | LYIRLWOZQUEAOF-FGRDXJNISA-N |
| XLogP | 3.12 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|