C11H11N5S3 — CID 115382892
2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3H-benzimidazol-5-amine (PubChem CID 115382892) has the molecular formula C11H11N5S3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 115382892 |
| Molecular Formula | C11H11N5S3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3H-benzimidazol-5-amine |
| SMILES | CSc1nnc(SCc2nc3ccc(N)cc3[nH]2)s1 |
| InChI | InChI=1S/C11H11N5S3/c1-17-10-15-16-11(19-10)18-5-9-13-7-3-2-6(12)4-8(7)14-9/h2-4H,5,12H2,1H3,(H,13,14) |
| InChIKey | DDRORQNOQWPADW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|