C13H13N5S3 — CID 115383671
[3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]quinolin-2-yl]hydrazine (PubChem CID 115383671) has the molecular formula C13H13N5S3 and a molecular weight of 335.48 g/mol. Its IUPAC name is [3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]quinolin-2-yl]hydrazine.
| Compound Name | [3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]quinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 115383671 |
| Molecular Formula | C13H13N5S3 |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | [3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]quinolin-2-yl]hydrazine |
| SMILES | CSc1nnc(SCc2cc3ccccc3nc2NN)s1 |
| InChI | InChI=1S/C13H13N5S3/c1-19-12-17-18-13(21-12)20-7-9-6-8-4-2-3-5-10(8)15-11(9)16-14/h2-6H,7,14H2,1H3,(H,15,16) |
| InChIKey | BWERMMYYMJIHFS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|