C25H32N2O2 — CID 11538407
1-adamantyl-[7-(4-methylpiperazin-1-yl)-2H-chromen-3-yl]methanone (PubChem CID 11538407) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-adamantyl-[7-(4-methylpiperazin-1-yl)-2H-chromen-3-yl]methanone.
| Compound Name | 1-adamantyl-[7-(4-methylpiperazin-1-yl)-2H-chromen-3-yl]methanone |
|---|---|
| PubChem CID | 11538407 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-adamantyl-[7-(4-methylpiperazin-1-yl)-2H-chromen-3-yl]methanone |
| SMILES | CN1CCN(c2ccc3c(c2)OCC(C(=O)C24CC5CC(CC(C5)C2)C4)=C3)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-26-4-6-27(7-5-26)22-3-2-20-11-21(16-29-23(20)12-22)24(28)25-13-17-8-18(14-25)10-19(9-17)15-25/h2-3,11-12,17-19H,4-10,13-16H2,1H3 |
| InChIKey | GGSNOFYZWQGIFQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|