C10H9N5S — CID 115389620
6-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridine-3-carbonitrile (PubChem CID 115389620) has the molecular formula C10H9N5S and a molecular weight of 231.28 g/mol. Its IUPAC name is 6-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 115389620 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridine-3-carbonitrile |
| SMILES | CCn1c(-c2ccc(C#N)cn2)n[nH]c1=S |
| InChI | InChI=1S/C10H9N5S/c1-2-15-9(13-14-10(15)16)8-4-3-7(5-11)6-12-8/h3-4,6H,2H2,1H3,(H,14,16) |
| InChIKey | WWVBXNIQRRTKQX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|