C13H24BrN3 — CID 115399568
3-(bromomethyl)-4-ethyl-5-(2,4,4-trimethylpentyl)-1,2,4-triazole (PubChem CID 115399568) has the molecular formula C13H24BrN3 and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-(bromomethyl)-4-ethyl-5-(2,4,4-trimethylpentyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-4-ethyl-5-(2,4,4-trimethylpentyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115399568 |
| Molecular Formula | C13H24BrN3 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(bromomethyl)-4-ethyl-5-(2,4,4-trimethylpentyl)-1,2,4-triazole |
| SMILES | CCn1c(CBr)nnc1CC(C)CC(C)(C)C |
| InChI | InChI=1S/C13H24BrN3/c1-6-17-11(15-16-12(17)9-14)7-10(2)8-13(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | MEWBKZCWLIHDQP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|