C22H18IN3O7 — CID 1154023
[3-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate (PubChem CID 1154023) has the molecular formula C22H18IN3O7 and a molecular weight of 563.30 g/mol. Its IUPAC name is [3-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [3-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 1154023 |
| Molecular Formula | C22H18IN3O7 |
| Molecular Weight | 563.30 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | [3-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1cc(I)cc(C)c1OCC(=O)NN=Cc1cccc(OC(=O)c2ccc([N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C22H18IN3O7/c1-13-8-16(23)9-14(2)21(13)31-12-19(27)25-24-11-15-4-3-5-17(10-15)32-22(28)18-6-7-20(33-18)26(29)30/h3-11H,12H2,1-2H3,(H,25,27) |
| InChIKey | VLFKMHRQKSGIBB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|