C14H12FN3O2 — CID 115404113
2-(3-fluorophenyl)-5,7-dimethoxyimidazo[1,2-a]pyrimidine (PubChem CID 115404113) has the molecular formula C14H12FN3O2 and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5,7-dimethoxyimidazo[1,2-a]pyrimidine.
| Compound Name | 2-(3-fluorophenyl)-5,7-dimethoxyimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 115404113 |
| Molecular Formula | C14H12FN3O2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(3-fluorophenyl)-5,7-dimethoxyimidazo[1,2-a]pyrimidine |
| SMILES | COc1cc(OC)n2cc(-c3cccc(F)c3)nc2n1 |
| InChI | InChI=1S/C14H12FN3O2/c1-19-12-7-13(20-2)18-8-11(16-14(18)17-12)9-4-3-5-10(15)6-9/h3-8H,1-2H3 |
| InChIKey | BHLMKARRALDSJH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |