C14H11FN4O2 — CID 8990468
6-(3-fluorophenyl)-3,8-dimethylpteridine-2,4-dione (PubChem CID 8990468) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-3,8-dimethylpteridine-2,4-dione.
| Compound Name | 6-(3-fluorophenyl)-3,8-dimethylpteridine-2,4-dione |
|---|---|
| PubChem CID | 8990468 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 6-(3-fluorophenyl)-3,8-dimethylpteridine-2,4-dione |
| SMILES | Cn1cc(-c2cccc(F)c2)nc2c(=O)n(C)c(=O)nc1-2 |
| InChI | InChI=1S/C14H11FN4O2/c1-18-7-10(8-4-3-5-9(15)6-8)16-11-12(18)17-14(21)19(2)13(11)20/h3-7H,1-2H3 |
| InChIKey | QIZZGONYHHKZKJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |