C16H13FN2O — CID 115404547
13-fluoro-9,9-dimethyl-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaene (PubChem CID 115404547) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 13-fluoro-9,9-dimethyl-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaene.
| Compound Name | 13-fluoro-9,9-dimethyl-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaene |
|---|---|
| PubChem CID | 115404547 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 13-fluoro-9,9-dimethyl-8-oxa-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaene |
| SMILES | CC1(C)Oc2ccccc2-c2nc3ccc(F)cn3c21 |
| InChI | InChI=1S/C16H13FN2O/c1-16(2)15-14(11-5-3-4-6-12(11)20-16)18-13-8-7-10(17)9-19(13)15/h3-9H,1-2H3 |
| InChIKey | GPFBALICUJKGJA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |