C12H26N4 — CID 115415895
2-(1,4-dimethylpiperazin-2-yl)-N,N-diethylethanimidamide (PubChem CID 115415895) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-2-yl)-N,N-diethylethanimidamide.
| Compound Name | 2-(1,4-dimethylpiperazin-2-yl)-N,N-diethylethanimidamide |
|---|---|
| PubChem CID | 115415895 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-2-yl)-N,N-diethylethanimidamide |
| SMILES | [H]/N=C(/CC1CN(C)CCN1C)N(CC)CC |
| InChI | InChI=1S/C12H26N4/c1-5-16(6-2)12(13)9-11-10-14(3)7-8-15(11)4/h11,13H,5-10H2,1-4H3/b13-12- |
| InChIKey | YMQSTICKQGQCEG-SEYXRHQNSA-N |
| XLogP | 0.94 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|