C10H22N2 — CID 63179219
N,N-diethyl-4-methylpentanimidamide (PubChem CID 63179219) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N,N-diethyl-4-methylpentanimidamide.
| Compound Name | N,N-diethyl-4-methylpentanimidamide |
|---|---|
| PubChem CID | 63179219 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N,N-diethyl-4-methylpentanimidamide |
| SMILES | [H]/N=C(\CCC(C)C)N(CC)CC |
| InChI | InChI=1S/C10H22N2/c1-5-12(6-2)10(11)8-7-9(3)4/h9,11H,5-8H2,1-4H3/b11-10+ |
| InChIKey | IFDSDBAPTVDSRO-ZHACJKMWSA-N |
| XLogP | 2.74 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|