C12H20FN3 — CID 115416258
N,N-dibutyl-6-fluoropyrimidin-4-amine (PubChem CID 115416258) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is N,N-dibutyl-6-fluoropyrimidin-4-amine.
| Compound Name | N,N-dibutyl-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 115416258 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N,N-dibutyl-6-fluoropyrimidin-4-amine |
| SMILES | CCCCN(CCCC)c1cc(F)ncn1 |
| InChI | InChI=1S/C12H20FN3/c1-3-5-7-16(8-6-4-2)12-9-11(13)14-10-15-12/h9-10H,3-8H2,1-2H3 |
| InChIKey | HGNRCXQMMYMUNJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |