C11H13ClO — CID 115417859
(1S)-7-chloro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 115417859) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is (1S)-7-chloro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S)-7-chloro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 115417859 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1S)-7-chloro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CC1CC[C@H](O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H13ClO/c1-7-2-5-11(13)10-6-8(12)3-4-9(7)10/h3-4,6-7,11,13H,2,5H2,1H3/t7?,11-/m0/s1 |
| InChIKey | ALPHUDNPWASJLT-QRIDDKLISA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |