C11H11BrF2O — CID 115417907
(1S)-7-bromo-5,8-difluoro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 115417907) has the molecular formula C11H11BrF2O and a molecular weight of 277.11 g/mol. Its IUPAC name is (1S)-7-bromo-5,8-difluoro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S)-7-bromo-5,8-difluoro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 115417907 |
| Molecular Formula | C11H11BrF2O |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (1S)-7-bromo-5,8-difluoro-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CC1CC[C@H](O)c2c(F)c(Br)cc(F)c21 |
| InChI | InChI=1S/C11H11BrF2O/c1-5-2-3-8(15)10-9(5)7(13)4-6(12)11(10)14/h4-5,8,15H,2-3H2,1H3/t5?,8-/m0/s1 |
| InChIKey | AHPIOIUTRVPGMD-DWHDZERNSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|