C11H9BrF2O — CID 115417432
7-bromo-5,8-difluoro-4-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 115417432) has the molecular formula C11H9BrF2O and a molecular weight of 275.09 g/mol. Its IUPAC name is 7-bromo-5,8-difluoro-4-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-bromo-5,8-difluoro-4-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 115417432 |
| Molecular Formula | C11H9BrF2O |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 7-bromo-5,8-difluoro-4-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1CCC(=O)c2c(F)c(Br)cc(F)c21 |
| InChI | InChI=1S/C11H9BrF2O/c1-5-2-3-8(15)10-9(5)7(13)4-6(12)11(10)14/h4-5H,2-3H2,1H3 |
| InChIKey | WRLWNZHWEKLXOD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|